CAS 1345471-26-2
:1-Bromo-3-[(1-methylethyl)sulfinyl]benzene
Description:
1-Bromo-3-[(1-methylethyl)sulfinyl]benzene, with the CAS number 1345471-26-2, is an organic compound characterized by the presence of a bromine atom and a sulfinyl group attached to a benzene ring. The sulfinyl group, derived from sulfoxides, contributes to the compound's reactivity and polarity, influencing its solubility in various solvents. The presence of the bromine atom enhances its electrophilic character, making it a potential candidate for nucleophilic substitution reactions. This compound is likely to exhibit moderate to high stability under standard conditions, but its reactivity can be influenced by the surrounding environment, such as temperature and the presence of other reactive species. Additionally, the branched alkyl group (isopropyl) attached to the sulfinyl group may affect steric hindrance, impacting its reactivity and interaction with other molecules. Overall, 1-Bromo-3-[(1-methylethyl)sulfinyl]benzene is a versatile compound with potential applications in organic synthesis and medicinal chemistry.
Formula:C9H11BrOS
InChI:InChI=1S/C9H11BrOS/c1-7(2)12(11)9-5-3-4-8(10)6-9/h3-7H,1-2H3
InChI key:InChIKey=LRQCRBOMTRAHLA-UHFFFAOYSA-N
SMILES:S(C(C)C)(=O)C1=CC(Br)=CC=C1
Synonyms:- Benzene, 1-bromo-3-[(1-methylethyl)sulfinyl]-
- 1-Bromo-3-[(1-methylethyl)sulfinyl]benzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
