CymitQuimica logo

CAS 1345471-30-8

:

2′-Amino-N,N-dimethyl[1,1′-biphenyl]-4-carboxamide

Description:
2′-Amino-N,N-dimethyl[1,1′-biphenyl]-4-carboxamide, identified by its CAS number 1345471-30-8, is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. This compound features an amino group (-NH2) and a carboxamide group (-C(=O)NH2) attached to the biphenyl framework, along with two methyl groups (-CH3) on the nitrogen atom, contributing to its dimethylamino functionality. The presence of these functional groups suggests that the compound may exhibit properties such as solubility in polar solvents and potential biological activity, making it of interest in medicinal chemistry. The molecular structure allows for various interactions, including hydrogen bonding, which can influence its reactivity and stability. Additionally, the biphenyl moiety may impart unique electronic properties, potentially affecting its behavior in chemical reactions or interactions with biological targets. Overall, this compound's characteristics make it a subject of interest for further research in various chemical and pharmaceutical applications.
Formula:C15H16N2O
InChI:InChI=1S/C15H16N2O/c1-17(2)15(18)12-9-7-11(8-10-12)13-5-3-4-6-14(13)16/h3-10H,16H2,1-2H3
InChI key:InChIKey=YROKUIIRNXTBPM-UHFFFAOYSA-N
SMILES:NC1=C(C2=CC=C(C(N(C)C)=O)C=C2)C=CC=C1
Synonyms:
  • [1,1′-Biphenyl]-4-carboxamide, 2′-amino-N,N-dimethyl-
  • 2′-Amino-N,N-dimethyl[1,1′-biphenyl]-4-carboxamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.