CAS 1345471-31-9
:2′-Cyano-4-fluoro[1,1′-biphenyl]-3-carboxylic acid
Description:
2′-Cyano-4-fluoro[1,1′-biphenyl]-3-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a cyano group (-CN) at the 2' position and a fluoro group (-F) at the 4 position introduces significant polarity and reactivity to the molecule. Additionally, the carboxylic acid functional group (-COOH) at the 3 position contributes to its acidic properties and potential for hydrogen bonding. This compound is likely to exhibit characteristics typical of aromatic compounds, such as stability and resonance, while the functional groups may influence its solubility, reactivity, and potential applications in pharmaceuticals or materials science. The specific arrangement of substituents can also affect its electronic properties, making it a candidate for various chemical reactions, including nucleophilic substitutions or coupling reactions. Overall, 2′-Cyano-4-fluoro[1,1′-biphenyl]-3-carboxylic acid is a versatile compound with potential utility in synthetic organic chemistry.
Formula:C14H8FNO2
InChI:InChI=1S/C14H8FNO2/c15-13-6-5-9(7-12(13)14(17)18)11-4-2-1-3-10(11)8-16/h1-7H,(H,17,18)
InChI key:InChIKey=ALXMYYDZKCKBFA-UHFFFAOYSA-N
SMILES:C(#N)C1=C(C2=CC(C(O)=O)=C(F)C=C2)C=CC=C1
Synonyms:- [1,1′-Biphenyl]-3-carboxylic acid, 2′-cyano-4-fluoro-
- 2′-Cyano-4-fluoro[1,1′-biphenyl]-3-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.