CymitQuimica logo

CAS 1345471-39-7

:

1-(Cyclopropylmethyl)-5-iodo-1H-pyrazole

Description:
1-(Cyclopropylmethyl)-5-iodo-1H-pyrazole is a chemical compound characterized by its unique structure, which includes a pyrazole ring substituted with a cyclopropylmethyl group and an iodine atom at the 5-position. This compound is notable for its potential biological activity, particularly in medicinal chemistry, where pyrazole derivatives are often explored for their pharmacological properties. The presence of the iodine atom can enhance the lipophilicity and biological activity of the molecule, making it a candidate for further research in drug development. Additionally, the cyclopropylmethyl group may influence the compound's steric and electronic properties, affecting its interaction with biological targets. The compound's molecular structure contributes to its reactivity and stability, which are important factors in its synthesis and application. As with many halogenated compounds, it may exhibit unique properties such as increased reactivity or altered solubility compared to its non-iodinated counterparts. Overall, 1-(Cyclopropylmethyl)-5-iodo-1H-pyrazole represents a class of compounds with significant interest in both synthetic and medicinal chemistry.
Formula:C7H9IN2
InChI:InChI=1S/C7H9IN2/c8-7-3-4-9-10(7)5-6-1-2-6/h3-4,6H,1-2,5H2
InChI key:InChIKey=ZHDDOQWIKLEOBV-UHFFFAOYSA-N
SMILES:C(N1C(I)=CC=N1)C2CC2
Synonyms:
  • 1-(Cyclopropylmethyl)-5-iodo-1H-pyrazole
  • 1H-Pyrazole, 1-(cyclopropylmethyl)-5-iodo-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.