CAS 1345471-46-6

4′-Amino-4-fluoro[1,1′-biphenyl]-3-carboxylic acid

Description:

4′-Amino-4-fluoro[1,1′-biphenyl]-3-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of an amino group (-NH2) and a carboxylic acid group (-COOH) contributes to its functionality, making it a potential candidate for various chemical reactions and applications in pharmaceuticals or agrochemicals. The fluorine atom, located at the para position relative to the amino group, can influence the compound's electronic properties and reactivity. This compound is likely to exhibit polar characteristics due to the presence of both the amino and carboxylic acid groups, which can engage in hydrogen bonding. Its molecular structure suggests that it may have applications in medicinal chemistry, particularly in the development of drugs targeting specific biological pathways. Additionally, the compound's stability and solubility in various solvents would depend on the pH and the presence of other functional groups in a given formulation.

Formula: C₁₃H₁₀FNO₂

InChI: InChI=1S/C13H10FNO2/c14-12-6-3-9(7-11(12)13(16)17)8-1-4-10(15)5-2-8/h1-7H,15H2,(H,16,17)

InChI key: InChIKey=HALRDBNKEGEYSJ-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C=C(C=CC1F)C2=CC=C(N)C=C2

Synonyms:

• [1,1′-Biphenyl]-3-carboxylic acid, 4′-amino-4-fluoro-
• 4′-Amino-4-fluoro[1,1′-biphenyl]-3-carboxylic acid
• 5-(4-AMinophenyl)-2-fluorobenzoic acid