CAS 1345471-47-7
:4′-Fluoro-3′-methoxy[1,1′-biphenyl]-2-amine
Description:
4′-Fluoro-3′-methoxy[1,1′-biphenyl]-2-amine is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a fluoro group at the para position and a methoxy group at the meta position on one of the phenyl rings contributes to its unique chemical properties. The amine functional group at the ortho position enhances its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. This compound may exhibit interesting biological activities due to its structural features, which can influence its interaction with biological targets. Additionally, its solubility and stability can be affected by the substituents on the biphenyl framework. As with many organic compounds, safety and handling precautions should be observed, particularly regarding its potential toxicity and environmental impact. Overall, 4′-Fluoro-3′-methoxy[1,1′-biphenyl]-2-amine represents a versatile structure in organic synthesis and medicinal chemistry.
Formula:C13H12FNO
InChI:InChI=1S/C13H12FNO/c1-16-13-8-9(6-7-11(13)14)10-4-2-3-5-12(10)15/h2-8H,15H2,1H3
InChI key:InChIKey=JTRHYQHOKRFSIG-UHFFFAOYSA-N
SMILES:NC1=C(C=CC=C1)C2=CC(OC)=C(F)C=C2
Synonyms:- 4′-Fluoro-3′-methoxy[1,1′-biphenyl]-2-amine
- [1,1′-Biphenyl]-2-amine, 4′-fluoro-3′-methoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.