CAS 1345471-50-2
:5-Bromo-1-chloro-3-methoxy-2-(phenylmethoxy)benzene
Description:
5-Bromo-1-chloro-3-methoxy-2-(phenylmethoxy)benzene is an organic compound characterized by its complex aromatic structure, which includes multiple substituents that influence its chemical properties. The presence of bromine and chlorine atoms introduces halogen functionalities, which can enhance reactivity and affect the compound's electronic properties. The methoxy groups (-OCH3) contribute to the compound's polarity and can participate in hydrogen bonding, potentially influencing solubility in various solvents. The phenylmethoxy group adds to the compound's hydrophobic character and can affect its interactions with biological systems. This compound may exhibit interesting pharmacological properties due to its structural features, making it a candidate for further research in medicinal chemistry. Its synthesis and reactivity can be influenced by the positions of the substituents on the benzene ring, which can lead to diverse chemical behavior in reactions such as electrophilic aromatic substitution. Overall, the unique combination of halogen and methoxy substituents makes this compound a subject of interest in both synthetic and applied chemistry contexts.
Formula:C14H12BrClO2
InChI:InChI=1S/C14H12BrClO2/c1-17-13-8-11(15)7-12(16)14(13)18-9-10-5-3-2-4-6-10/h2-8H,9H2,1H3
InChI key:InChIKey=PSGRAIZMYQRZSL-UHFFFAOYSA-N
SMILES:O(CC1=CC=CC=C1)C2=C(OC)C=C(Br)C=C2Cl
Synonyms:- 5-Bromo-1-chloro-3-methoxy-2-(phenylmethoxy)benzene
- Benzene, 5-bromo-1-chloro-3-methoxy-2-(phenylmethoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.