CAS 1345471-53-5

5-Iodo-1-(2-methylpropyl)-1H-pyrazole

Description:

5-Iodo-1-(2-methylpropyl)-1H-pyrazole is a chemical compound characterized by its pyrazole ring, which is a five-membered aromatic heterocycle containing two nitrogen atoms. The presence of an iodine atom at the 5-position of the pyrazole ring contributes to its reactivity and potential applications in various chemical reactions, including nucleophilic substitutions. The 1-(2-methylpropyl) substituent indicates that there is a branched alkyl group attached to the nitrogen at the 1-position, which can influence the compound's solubility and steric properties. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure suggests potential interactions with biological targets, and the iodine atom may enhance its lipophilicity. As with many halogenated compounds, it is essential to consider safety and environmental implications during handling and disposal. Overall, 5-Iodo-1-(2-methylpropyl)-1H-pyrazole represents a unique structure that may serve as a valuable intermediate in organic synthesis or as a lead compound in drug discovery.

Formula: C₇H₁₁IN₂

InChI: InChI=1S/C7H11IN2/c1-6(2)5-10-7(8)3-4-9-10/h3-4,6H,5H2,1-2H3

InChI key: InChIKey=WRMLAMSELPMHOT-UHFFFAOYSA-N

SMILES: C(C(C)C)N1C(I)=CC=N1

Synonyms:

• 1H-Pyrazole, 5-iodo-1-(2-methylpropyl)-
• 5-Iodo-1-(2-methylpropyl)-1H-pyrazole

5-Iodo-1-isobutylpyrazole

CAS: 1345471-53-5

Versatile small molecule scaffold

Formula: C₇H₁₁IN₂

Purity: Min. 95%

Molecular weight: 250.08 g/mol

Ref: 3D-VDC47153