CAS 1345471-69-3

1-Bromo-5-fluoro-4-methyl-2-nitrobenzene

Description:

1-Bromo-5-fluoro-4-methyl-2-nitrobenzene is an aromatic compound characterized by the presence of a bromine atom, a fluorine atom, a methyl group, and a nitro group attached to a benzene ring. The molecular structure features a nitro group (-NO2) at the 2-position, a methyl group (-CH3) at the 4-position, a bromine atom (Br) at the 1-position, and a fluorine atom (F) at the 5-position of the benzene ring. This compound is typically a yellow to brown solid at room temperature and is known for its potential applications in organic synthesis and as an intermediate in the production of pharmaceuticals and agrochemicals. Its reactivity is influenced by the electron-withdrawing nature of the nitro group and the halogen substituents, which can affect electrophilic aromatic substitution reactions. Additionally, the presence of multiple functional groups may impart unique physical and chemical properties, such as solubility in organic solvents and varying degrees of stability under different conditions. Safety precautions should be taken when handling this compound due to its potential toxicity and environmental impact.

Formula: C₇H₅BrFNO₂

InChI: InChI=1S/C7H5BrFNO2/c1-4-2-7(10(11)12)5(8)3-6(4)9/h2-3H,1H3

InChI key: InChIKey=TVQLPBXVLOYFQS-UHFFFAOYSA-N

SMILES: N(=O)(=O)C1=C(Br)C=C(F)C(C)=C1

Synonyms:

• 1-Bromo-5-fluoro-4-methyl-2-nitrobenzene
• Benzene, 1-bromo-5-fluoro-4-methyl-2-nitro-
• 4-Bromo-2-fluoro-5-nitrotoluene

1-Bromo-5-fluoro-4-methyl-2-nitrobenzene

CAS: 1345471-69-3

Formula: C₇H₅BrFNO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 234.0225

Ref: IN-DA007ZXS

4-Bromo-2-fluoro-5-nitrotoluene

CAS: 1345471-69-3

4-Bromo-2-fluoro-5-nitrotoluene

Purity: ≥95%

Molecular weight: 234.02g/mol

Ref: 54-PC408231

4-Bromo-2-fluoro-5-nitrotoluene

CAS: 1345471-69-3

4-Bromo-2-fluoro-5-nitrotoluene is a chemical building block that is used as a research and speciality chemical. It has been shown to be useful in the synthesis of complex compounds, including pharmaceuticals and dyes. 4-Bromo-2-fluoro-5-nitrotoluene is also used as a reagent for the reaction with other chemicals, such as thiourea, to form 2,4,6-trichlorophenylacetonitrile. This compound is classified as hazardous by the American Chemical Society (ACS) because it can cause irritation to the skin and eyes.

Formula: C₇H₅BrFNO₂

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 234.02 g/mol

Ref: 3D-FB67155

1-Bromo-5-fluoro-4-methyl-2-nitrobenzene

CAS: 1345471-69-3

Formula: C₇H₅BrFNO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 234.024

Ref: 10-F095103