CAS 1345471-96-6

3′-Chloro-5′-fluoro[1,1′-biphenyl]-4-amine

Description:

3′-Chloro-5′-fluoro[1,1′-biphenyl]-4-amine is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a chloro group at the 3′ position and a fluoro group at the 5′ position, along with an amino group at the 4-position of one of the phenyl rings, contributes to its unique chemical properties. This compound is likely to exhibit moderate to high lipophilicity due to the aromatic nature of the biphenyl structure, which can influence its solubility in organic solvents. The halogen substituents (chlorine and fluorine) can also affect the compound's reactivity, stability, and potential biological activity. Additionally, the amino group may participate in hydrogen bonding, impacting its interactions in various chemical environments. Overall, this compound may have applications in pharmaceuticals or materials science, although specific applications would depend on further research into its properties and behavior in different contexts.

Formula: C₁₂H₉ClFN

InChI: InChI=1S/C12H9ClFN/c13-10-5-9(6-11(14)7-10)8-1-3-12(15)4-2-8/h1-7H,15H2

InChI key: InChIKey=FSXLTSAXLFETHZ-UHFFFAOYSA-N

SMILES: ClC=1C=C(C=C(F)C1)C2=CC=C(N)C=C2

Synonyms:

• [1,1′-Biphenyl]-4-amine, 3′-chloro-5′-fluoro-
• 3′-Chloro-5′-fluoro[1,1′-biphenyl]-4-amine