CymitQuimica logo

CAS 1345472-01-6

:

3-Methoxy-4′-(phenylmethoxy)-1,1′-biphenyl

Description:
3-Methoxy-4′-(phenylmethoxy)-1,1′-biphenyl is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of methoxy groups at specific positions on the biphenyl framework contributes to its chemical properties, including its solubility and reactivity. This compound typically exhibits moderate polarity due to the methoxy substituents, which can influence its interactions in various chemical environments. It may be utilized in organic synthesis, potentially serving as an intermediate in the production of more complex molecules or as a ligand in coordination chemistry. Additionally, the presence of multiple aromatic rings suggests that it may exhibit interesting electronic properties, such as fluorescence or conductivity, making it a candidate for applications in materials science or organic electronics. As with many organic compounds, its stability and reactivity can be influenced by factors such as temperature, solvent, and the presence of other functional groups. Safety data should be consulted for handling and usage guidelines.
Formula:C20H18O2
InChI:InChI=1S/C20H18O2/c1-21-20-9-5-8-18(14-20)17-10-12-19(13-11-17)22-15-16-6-3-2-4-7-16/h2-14H,15H2,1H3
InChI key:InChIKey=ZCFMRUNUYUUWGS-UHFFFAOYSA-N
SMILES:O(C)C=1C=C(C2=CC=C(OCC3=CC=CC=C3)C=C2)C=CC1
Synonyms:
  • 1,1′-Biphenyl, 3-methoxy-4′-(phenylmethoxy)-
  • 3-Methoxy-4′-(phenylmethoxy)-1,1′-biphenyl
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.