CAS 1345472-03-8

4-Fluoro-3,4′-dimethyl-1,1′-biphenyl

Description:

4-Fluoro-3,4′-dimethyl-1,1′-biphenyl is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a fluorine atom at the 4-position of one phenyl ring and two methyl groups at the 3 and 4′ positions of the other ring contributes to its unique chemical properties. This compound is typically a colorless to pale yellow solid at room temperature, exhibiting moderate solubility in organic solvents. Its molecular structure suggests potential applications in materials science, particularly in the development of liquid crystals and organic semiconductors. The fluorine substituent can enhance the compound's thermal stability and influence its electronic properties, making it of interest in various chemical and industrial applications. Additionally, the presence of methyl groups may affect its steric hindrance and reactivity. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards.

Formula: C₁₄H₁₃F

InChI: InChI=1S/C14H13F/c1-10-3-5-12(6-4-10)13-7-8-14(15)11(2)9-13/h3-9H,1-2H3

InChI key: InChIKey=LNPXILHXJFOCBT-UHFFFAOYSA-N

SMILES: CC=1C=C(C=CC1F)C2=CC=C(C)C=C2

Synonyms:

• 4-Fluoro-3,4′-dimethyl-1,1′-biphenyl
• 3,4′-Dimethyl-4-fluorobiphenyl
• 1,1′-Biphenyl, 4-fluoro-3,4′-dimethyl-