CymitQuimica logo

CAS 1345472-06-1

:

5-Butoxy-2,3-dichloropyridine

Description:
5-Butoxy-2,3-dichloropyridine is an organic compound characterized by its pyridine ring, which is substituted at the 2 and 3 positions with chlorine atoms and at the 5 position with a butoxy group. This structure imparts specific chemical properties, including moderate polarity due to the presence of the electronegative chlorine atoms and the butoxy group, which can influence solubility in various solvents. The compound is likely to exhibit biological activity, making it of interest in pharmaceutical and agrochemical research. Its synthesis typically involves halogenation and etherification reactions. The presence of chlorine substituents can enhance the compound's reactivity, potentially allowing for further functionalization. Additionally, the butoxy group may contribute to the compound's lipophilicity, affecting its interaction with biological membranes. Safety data should be consulted, as halogenated compounds can pose environmental and health risks. Overall, 5-Butoxy-2,3-dichloropyridine represents a versatile structure in organic chemistry with potential applications in various fields.
Formula:C9H11Cl2NO
InChI:InChI=1S/C9H11Cl2NO/c1-2-3-4-13-7-5-8(10)9(11)12-6-7/h5-6H,2-4H2,1H3
InChI key:InChIKey=ISBKBHNNRGUINP-UHFFFAOYSA-N
SMILES:O(CCCC)C=1C=C(Cl)C(Cl)=NC1
Synonyms:
  • 5-Butoxy-2,3-dichloropyridine
  • Pyridine, 5-butoxy-2,3-dichloro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.