CAS 1345472-11-8

2,4-Dibromo-5,6-dichloro-3-pyridinol

Description:

2,4-Dibromo-5,6-dichloro-3-pyridinol is a chemical compound characterized by its complex halogenated pyridine structure. It features two bromine atoms and two chlorine atoms attached to a pyridine ring, specifically at the 2, 4, 5, and 6 positions, along with a hydroxyl group (-OH) at the 3 position. This compound is typically a solid at room temperature and may exhibit a range of colors depending on its purity and form. It is known for its potential applications in agricultural chemistry, particularly as a pesticide or herbicide, due to its ability to disrupt biological processes in target organisms. The presence of multiple halogen substituents enhances its reactivity and may influence its solubility in various solvents. Additionally, the compound's structure suggests potential for various chemical reactions, including nucleophilic substitutions and coupling reactions. Safety data should be consulted, as halogenated compounds can pose environmental and health risks. Proper handling and disposal procedures are essential when working with such substances.

Formula: C₅HBr₂Cl₂NO

InChI: InChI=1S/C5HBr2Cl2NO/c6-1-2(8)5(9)10-4(7)3(1)11/h11H

InChI key: InChIKey=ZGYANUDOWXOVGB-UHFFFAOYSA-N

SMILES: ClC=1C(Br)=C(O)C(Br)=NC1Cl

Synonyms:

• 3-Pyridinol, 2,4-dibromo-5,6-dichloro-
• 2,4-Dibromo-5,6-dichloro-3-pyridinol
• 2,4-Dibromo-3-hydroxy-5,6-dichloropyridine
• 2,4-Dibromo-5,6-dichloropyridin-3-ol