CAS 1345472-21-0

1-Bromo-5-fluoro-2-iodo-4-(trifluoromethyl)benzene

Description:

1-Bromo-5-fluoro-2-iodo-4-(trifluoromethyl)benzene is an organohalogen compound characterized by the presence of multiple halogen substituents on a benzene ring. This compound features a bromine atom, a fluorine atom, and an iodine atom, along with a trifluoromethyl group (-CF3) attached to the aromatic system. The presence of these electronegative halogens significantly influences its chemical properties, including increased reactivity and potential applications in various fields such as pharmaceuticals and agrochemicals. The trifluoromethyl group is known for imparting lipophilicity and enhancing biological activity. Additionally, the compound's structure suggests potential for participating in nucleophilic substitution reactions, making it a candidate for further chemical transformations. Its unique combination of halogens may also affect its physical properties, such as boiling and melting points, solubility, and stability under different conditions. Overall, 1-Bromo-5-fluoro-2-iodo-4-(trifluoromethyl)benzene represents a complex and versatile chemical entity with potential utility in synthetic organic chemistry.

Formula: C₇H₂BrF₄I

InChI: InChI=1S/C7H2BrF4I/c8-4-2-5(9)3(1-6(4)13)7(10,11)12/h1-2H

InChI key: InChIKey=OVWVLQFJUMKKJF-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C1=C(F)C=C(Br)C(I)=C1

Synonyms:

• Benzene, 1-bromo-5-fluoro-2-iodo-4-(trifluoromethyl)-
• 1-Bromo-5-fluoro-2-iodo-4-(trifluoromethyl)benzene