CAS 1345472-32-3
:2′-Chloro-4′-methoxy[1,1′-biphenyl]-3-acetic acid
Description:
2′-Chloro-4′-methoxy[1,1′-biphenyl]-3-acetic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a chloro group at the 2′ position and a methoxy group at the 4′ position on one of the phenyl rings contributes to its unique chemical properties, influencing its reactivity and solubility. The acetic acid functional group at the 3-position adds acidity to the molecule, making it potentially useful in various chemical reactions and applications. This compound may exhibit biological activity, which could be of interest in pharmaceutical research. Its molecular structure suggests that it may participate in hydrogen bonding due to the carboxylic acid group, enhancing its solubility in polar solvents. Additionally, the presence of halogen and methoxy substituents can affect the compound's electronic properties, potentially influencing its interactions with biological targets or other chemical species. Overall, 2′-Chloro-4′-methoxy[1,1′-biphenyl]-3-acetic acid is a compound of interest in both synthetic and medicinal chemistry.
Formula:C15H13ClO3
InChI:InChI=1S/C15H13ClO3/c1-19-12-5-6-13(14(16)9-12)11-4-2-3-10(7-11)8-15(17)18/h2-7,9H,8H2,1H3,(H,17,18)
InChI key:InChIKey=LZVVTJZPQITTCW-UHFFFAOYSA-N
SMILES:ClC1=C(C=CC(OC)=C1)C2=CC(CC(O)=O)=CC=C2
Synonyms:- [1,1′-Biphenyl]-3-acetic acid, 2′-chloro-4′-methoxy-
- 2′-Chloro-4′-methoxy[1,1′-biphenyl]-3-acetic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
