CAS 1345472-33-4

4′-Fluoro-2′-methoxy[1,1′-biphenyl]-3-acetic acid

Description:

4′-Fluoro-2′-methoxy[1,1′-biphenyl]-3-acetic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a fluoro group at the para position and a methoxy group at the ortho position on one of the phenyl rings contributes to its unique chemical properties, including potential variations in polarity and reactivity. The acetic acid functional group introduces acidity to the molecule, allowing it to participate in various chemical reactions, such as esterification or amidation. This compound may exhibit interesting biological activities, making it a subject of interest in medicinal chemistry and drug development. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of compounds targeting specific biological pathways. Additionally, the presence of halogen and methoxy substituents can influence the compound's solubility and interaction with biological systems, which is crucial for its efficacy and safety in therapeutic applications.

Formula: C₁₅H₁₃FO₃

InChI: InChI=1S/C15H13FO3/c1-19-14-9-12(16)5-6-13(14)11-4-2-3-10(7-11)8-15(17)18/h2-7,9H,8H2,1H3,(H,17,18)

InChI key: InChIKey=OHFMGGFDQXYOFT-UHFFFAOYSA-N

SMILES: O(C)C1=C(C2=CC(CC(O)=O)=CC=C2)C=CC(F)=C1

Synonyms:

• 4′-Fluoro-2′-methoxy[1,1′-biphenyl]-3-acetic acid
• [1,1′-Biphenyl]-3-acetic acid, 4′-fluoro-2′-methoxy-