CAS 1345510-59-9

1-(Difluoromethyl)-N-methyl-1H-pyrazole-5-methanamine

Description:

1-(Difluoromethyl)-N-methyl-1H-pyrazole-5-methanamine is a chemical compound characterized by its unique structure, which includes a pyrazole ring substituted with a difluoromethyl group and a methylamine moiety. This compound typically exhibits properties associated with both pyrazole derivatives and amines, such as potential reactivity due to the presence of the difluoromethyl group, which can influence its electronic properties and steric hindrance. The presence of the nitrogen atoms in the pyrazole ring and the amine group suggests that it may engage in hydrogen bonding, making it potentially soluble in polar solvents. Additionally, the difluoromethyl group can enhance lipophilicity and may affect the compound's biological activity. As with many pyrazole derivatives, this compound may be of interest in medicinal chemistry for its potential applications in pharmaceuticals, particularly in the development of agrochemicals or therapeutic agents. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₆H₉F₂N₃

InChI: InChI=1S/C6H9F2N3/c1-9-4-5-2-3-10-11(5)6(7)8/h2-3,6,9H,4H2,1H3

InChI key: InChIKey=WLIOALRIKMUXBK-UHFFFAOYSA-N

SMILES: C(F)(F)N1C(CNC)=CC=N1

Synonyms:

• 1H-Pyrazole-5-methanamine, 1-(difluoromethyl)-N-methyl-
• 1-(Difluoromethyl)-N-methyl-1H-pyrazole-5-methanamine