CAS 1345510-64-6

1-Ethyl-N-methyl-3-(trifluoromethyl)-1H-pyrazole-5-methanamine

Description:

1-Ethyl-N-methyl-3-(trifluoromethyl)-1H-pyrazole-5-methanamine is a chemical compound characterized by its unique pyrazole structure, which includes a trifluoromethyl group that enhances its reactivity and potential biological activity. This compound features an ethyl group and a methyl group attached to the nitrogen atoms, contributing to its amine functionality. The presence of the trifluoromethyl group is significant, as it often imparts unique electronic properties and can influence the compound's lipophilicity and solubility in various solvents. The pyrazole ring is known for its diverse applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. Additionally, the compound's molecular structure suggests potential applications in agrochemicals or as a building block in organic synthesis. Its specific properties, such as melting point, boiling point, and solubility, would require empirical data for precise characterization, but its functional groups indicate a potential for varied reactivity in chemical reactions.

Formula: C₈H₁₂F₃N₃

InChI: InChI=1S/C8H12F3N3/c1-3-14-6(5-12-2)4-7(13-14)8(9,10)11/h4,12H,3,5H2,1-2H3

InChI key: InChIKey=OQMTVEOUKOKJJU-UHFFFAOYSA-N

SMILES: C(NC)C=1N(CC)N=C(C(F)(F)F)C1

Synonyms:

• 1-Ethyl-N-methyl-3-(trifluoromethyl)-1H-pyrazole-5-methanamine
• 1H-Pyrazole-5-methanamine, 1-ethyl-N-methyl-3-(trifluoromethyl)-