CAS 1345510-65-7

N-Methyl-1-(2,2,2-trifluoroethyl)-1H-pyrazole-3-methanamine

Description:

N-Methyl-1-(2,2,2-trifluoroethyl)-1H-pyrazole-3-methanamine is a chemical compound characterized by its unique structure, which includes a pyrazole ring substituted with a trifluoroethyl group and a methylamine moiety. This compound typically exhibits properties associated with both pyrazole derivatives and fluorinated compounds, such as increased lipophilicity and potential biological activity. The presence of the trifluoroethyl group can enhance the compound's stability and influence its interaction with biological targets, making it of interest in medicinal chemistry. Additionally, the methylamine group may contribute to its reactivity and solubility in various solvents. As a pyrazole derivative, it may also exhibit specific pharmacological properties, potentially acting as a ligand or inhibitor in biochemical pathways. The compound's CAS number, 1345510-65-7, allows for precise identification in chemical databases, facilitating research and development in various applications, including pharmaceuticals and agrochemicals. Overall, N-Methyl-1-(2,2,2-trifluoroethyl)-1H-pyrazole-3-methanamine represents a versatile structure with potential utility in diverse chemical and biological contexts.

Formula: C₇H₁₀F₃N₃

InChI: InChI=1S/C7H10F3N3/c1-11-4-6-2-3-13(12-6)5-7(8,9)10/h2-3,11H,4-5H2,1H3

InChI key: InChIKey=ZDOIMXDPVCXUSB-UHFFFAOYSA-N

SMILES: C(C(F)(F)F)N1N=C(CNC)C=C1

Synonyms:

• 1H-Pyrazole-3-methanamine, N-methyl-1-(2,2,2-trifluoroethyl)-
• N-Methyl-1-(2,2,2-trifluoroethyl)-1H-pyrazole-3-methanamine