
CAS 1345510-69-1
:5-Cyclopropyl-N,1-dimethyl-1H-pyrazole-3-methanamine
Description:
5-Cyclopropyl-N,1-dimethyl-1H-pyrazole-3-methanamine is a chemical compound characterized by its unique pyrazole structure, which includes a cyclopropyl group and a dimethylamino substituent. This compound features a five-membered ring containing two nitrogen atoms, contributing to its potential biological activity. The presence of the cyclopropyl group may influence its steric and electronic properties, potentially enhancing its interaction with biological targets. The dimethylamino group can enhance solubility and reactivity, making it a candidate for various applications in medicinal chemistry. Its molecular structure suggests potential uses in drug development, particularly in areas related to neuropharmacology or anti-inflammatory agents. The compound's CAS number, 1345510-69-1, allows for easy identification in chemical databases and literature. As with many pyrazole derivatives, it may exhibit interesting pharmacological properties, warranting further investigation into its synthesis, stability, and biological effects. Overall, this compound represents a fascinating area of study within organic and medicinal chemistry.
Formula:C9H15N3
InChI:InChI=1S/C9H15N3/c1-10-6-8-5-9(7-3-4-7)12(2)11-8/h5,7,10H,3-4,6H2,1-2H3
InChI key:InChIKey=DZIQQNCAVXCORX-UHFFFAOYSA-N
SMILES:CN1C(=CC(CNC)=N1)C2CC2
Synonyms:- 1H-Pyrazole-3-methanamine, 5-cyclopropyl-N,1-dimethyl-
- 5-Cyclopropyl-N,1-dimethyl-1H-pyrazole-3-methanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.