CAS 134563-22-7
:(R)-Benzyl 2-(pyrrolidine-1-carbonyl)pyrrolidine-1-carboxylate
Description:
(R)-Benzyl 2-(pyrrolidine-1-carbonyl)pyrrolidine-1-carboxylate, with the CAS number 134563-22-7, is a chiral compound that belongs to the class of pyrrolidine derivatives. This substance features a benzyl group and two pyrrolidine rings, which contribute to its structural complexity and potential biological activity. The presence of the carbonyl and carboxylate functional groups indicates that it may participate in various chemical reactions, including esterification and amide formation. The chirality of the molecule suggests that it may exhibit specific interactions with biological targets, making it of interest in medicinal chemistry and drug development. Its solubility and stability can vary depending on the solvent and environmental conditions, which are important factors for its application in research and industry. Additionally, the compound may have implications in the synthesis of other complex molecules, serving as a building block in organic synthesis. Overall, (R)-Benzyl 2-(pyrrolidine-1-carbonyl)pyrrolidine-1-carboxylate is a noteworthy compound for further exploration in chemical and pharmaceutical research.
Formula:C17H22N2O3
InChI:InChI=1/C17H22N2O3/c20-16(18-10-4-5-11-18)15-9-6-12-19(15)17(21)22-13-14-7-2-1-3-8-14/h1-3,7-8,15H,4-6,9-13H2
SMILES:c1ccc(cc1)COC(=O)N1CCCC1C(=O)N1CCCC1
Synonyms:- (R)-benzyl 2-(pyrrolidone-1-Carbonyl)Pyrrolidone-1-Carboxylate
- (R)-2-[(Pyrrolidin-1-yl)carbonyl]pyrrolidine-1-carboxylic acid benzyl ester
- 1-[N-(Benzyloxycarbonyl)-D-prolyl]pyrrolidine
- Benzyl 2-(Pyrrolidin-1-Ylcarbonyl)Pyrrolidine-1-Carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(R)-Benzyl 2-(pyrrolidine-1-carbonyl)pyrrolidine-1-carboxylate
CAS:Formula:C17H22N2O3Molecular weight:302.3682
