CAS 134577-43-8
:3-AMINO-6-BROMO-PYRIDIN-2-OL
Description:
3-Amino-6-bromo-pyridin-2-ol is a heterocyclic organic compound characterized by the presence of a pyridine ring substituted with an amino group and a bromine atom, along with a hydroxyl group. This compound typically exhibits properties associated with both amines and phenolic compounds, such as potential basicity due to the amino group and reactivity due to the hydroxyl group. The bromine substitution can influence its reactivity and solubility in various solvents. It is often used in medicinal chemistry and research due to its potential biological activity, including antimicrobial and anti-inflammatory properties. The presence of the bromine atom may also enhance its lipophilicity, affecting its pharmacokinetic properties. Additionally, the compound's structure allows for various synthetic modifications, making it a valuable intermediate in the synthesis of more complex molecules. Safety data should be consulted for handling, as halogenated compounds can pose specific health and environmental risks.
Formula:C5H6Br2N2O
InChI:InChI=1/C5H5BrN2O.BrH/c6-4-2-1-3(7)5(9)8-4;/h1-2H,7H2,(H,8,9);1H
SMILES:c1cc(Br)nc(c1N)O.Br
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
