CAS 1345847-73-5

Methyl 1-[(phenylamino)carbonyl]cyclopropanecarboxylate

Description:

Methyl 1-[(phenylamino)carbonyl]cyclopropanecarboxylate is an organic compound characterized by its cyclopropane structure, which is a three-membered carbon ring. This compound features a methyl ester functional group, contributing to its reactivity and solubility in organic solvents. The presence of a phenylamino group indicates that it has an aromatic amine functionality, which can influence its chemical behavior, including potential interactions in biological systems. The carbonyl group associated with the phenylamino moiety suggests that it may participate in various chemical reactions, such as nucleophilic attacks or condensation reactions. Additionally, the cyclopropane ring can impart unique strain-related properties, affecting the compound's stability and reactivity. Overall, this compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry and organic synthesis. Its specific applications and behavior would depend on further studies and characterization, including its reactivity, stability under different conditions, and potential biological activity.

Formula: C₁₂H₁₃NO₃

InChI: InChI=1S/C12H13NO3/c1-16-11(15)12(7-8-12)10(14)13-9-5-3-2-4-6-9/h2-6H,7-8H2,1H3,(H,13,14)

InChI key: InChIKey=KICPULRXSYFMDC-UHFFFAOYSA-N

SMILES: C(NC1=CC=CC=C1)(=O)C2(C(OC)=O)CC2

Synonyms:

• Cyclopropanecarboxylic acid, 1-[(phenylamino)carbonyl]-, methyl ester
• Methyl 1-[(phenylamino)carbonyl]cyclopropanecarboxylate
• Methyl 1-(phenylcarbamoyl)cyclopropanecarboxylate