CAS 13459-59-1

(2-[(4-CHLOROPHENYL)SULFANYL]PHENYL)METHANOL

Description:

(2-[(4-Chlorophenyl)sulfanyl]phenyl)methanol, with the CAS number 13459-59-1, is an organic compound characterized by its phenolic structure, which includes a hydroxymethyl group attached to a biphenyl framework. The presence of a chlorophenyl group introduces a chlorine substituent, which can influence the compound's reactivity and physical properties. This compound typically exhibits moderate solubility in organic solvents due to its hydrophobic aromatic rings, while the hydroxyl group can engage in hydrogen bonding, enhancing its solubility in polar solvents. The sulfanyl group contributes to the compound's potential as a nucleophile, making it relevant in various chemical reactions, including substitution and addition reactions. Additionally, the presence of the chlorophenyl moiety may impart biological activity, making it of interest in medicinal chemistry. Overall, the compound's unique structural features suggest potential applications in pharmaceuticals and materials science, although specific reactivity and stability would depend on the surrounding conditions and functional groups present.

Formula: C₁₃H₁₁ClOS

InChI: InChI=1/C13H11ClOS/c14-11-5-7-12(8-6-11)16-13-4-2-1-3-10(13)9-15/h1-8,15H,9H2

SMILES: c1ccc(c(c1)CO)Sc1ccc(cc1)Cl

Synonyms:

• Rarechem Al Bd 0304
• {2-[(4-chlorophenyl)sulfanyl]phenyl}methanol

{2-[(4-chlorophenyl)sulfanyl]phenyl} methanol

CAS: 13459-59-1

Formula: C₁₃H₁₁ClOS

Molecular weight: 250.7438

Ref: IN-DA007M2L