CAS 1346147-95-2

Ethyl 5-chloro-1,2,4-thiadiazole-3-carboxylate

Description:

Ethyl 5-chloro-1,2,4-thiadiazole-3-carboxylate is a chemical compound characterized by its unique structure, which includes a thiadiazole ring, a carboxylate group, and an ethyl ester. This compound typically exhibits properties associated with heterocyclic compounds, such as moderate solubility in organic solvents and potential reactivity due to the presence of the chlorine atom and the carboxylate functional group. The thiadiazole moiety contributes to its biological activity, making it of interest in pharmaceutical and agrochemical research. Ethyl 5-chloro-1,2,4-thiadiazole-3-carboxylate may also display specific spectral characteristics in techniques like NMR and IR spectroscopy, aiding in its identification and characterization. Its applications could range from serving as an intermediate in organic synthesis to potential use in developing herbicides or fungicides, depending on its biological activity. As with many chemical substances, safety data sheets should be consulted for handling and toxicity information.

Formula: C₅H₅ClN₂O₂S

InChI: InChI=1S/C5H5ClN2O2S/c1-2-10-4(9)3-7-5(6)11-8-3/h2H2,1H3

InChI key: InChIKey=ZIWPNSPYXAPZCU-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C1=NSC(Cl)=N1

Synonyms:

• Ethyl 5-chloro-1,2,4-thiadiazole-3-carboxylate
• 1,2,4-Thiadiazole-3-carboxylic acid, 5-chloro-, ethyl ester
• 5-Chloro-[1,2,4]thiadiazole-3-carboxylic acid ethyl ester