CAS 134615-22-8
:(S)-1-(3-Bromophenyl)Ethanol
Description:
(S)-1-(3-Bromophenyl)ethanol, with the CAS number 134615-22-8, is an organic compound characterized by its chiral structure, featuring a bromophenyl group attached to a secondary alcohol. The presence of the bromine atom on the aromatic ring significantly influences its chemical properties, including reactivity and polarity. This compound typically exhibits a specific optical rotation due to its chiral nature, which is important in applications where stereochemistry plays a crucial role, such as in pharmaceuticals. The hydroxyl (-OH) group contributes to its solubility in polar solvents and can participate in hydrogen bonding, affecting its boiling and melting points. Additionally, the bromine substituent can serve as a site for further chemical modifications, making it a versatile intermediate in organic synthesis. Overall, (S)-1-(3-Bromophenyl)ethanol is notable for its potential applications in medicinal chemistry and as a building block in the synthesis of more complex molecules.
Formula:C8H9BrO
InChI:InChI=1/C8H9BrO/c1-6(10)7-3-2-4-8(9)5-7/h2-6,10H,1H3/t6-/m0/s1
SMILES:C[C@@H](c1cccc(c1)Br)O
Synonyms:- (S)-3-Bromo-Alpha-Methylbenzyl Alcohol
- (1S)-1-(3-bromophenyl)ethanol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
(S)-1-(3-Bromophenyl)ethanol
CAS:Formula:C8H9BrOPurity:98%Color and Shape:LiquidMolecular weight:201.0605(S)-1-(3-Bromophenyl)ethanol
CAS:Formula:C8H9BrOPurity:98%Color and Shape:SolidMolecular weight:201.063(S)-1-(3-Bromophenyl)ethanol
CAS:(S)-1-(3-Bromophenyl)ethanol is an aromatic ketone that is used as a substrate for the preparation of other compounds. It has been shown to be effective in the oxidation of formate, with dehydrogenase activity. The enzyme was immobilized onto an ion-exchange resin, which improved its stability and allowed for the selective removal of byproducts. The enantiopurity of (S)-1-(3-bromophenyl)ethanol was determined using preparative gas chromatography and parameters such as alcohols and chiral phenylacetaldehyde.Formula:C8H9BrOPurity:Min. 95%Molecular weight:201.06 g/mol



