CAS 134615-37-5
:REVEROMYCIN A
Description:
Reveromycin A is a natural compound classified as a macrolide antibiotic, primarily derived from the fermentation of certain Streptomyces species. It exhibits a complex molecular structure characterized by a large lactone ring, which is typical of macrolides, and contains multiple functional groups that contribute to its biological activity. Reveromycin A is known for its potent antimicrobial properties, particularly against a range of Gram-positive bacteria and some fungi. Additionally, it has been studied for its potential anticancer effects, as it can inhibit cell proliferation and induce apoptosis in various cancer cell lines. The compound's mechanism of action involves interference with protein synthesis, which is a common feature among antibiotics. Reveromycin A is also notable for its relatively low toxicity to mammalian cells, making it a subject of interest in pharmaceutical research. Its unique chemical properties and biological activities make it a valuable compound in the field of medicinal chemistry and antibiotic development.
Formula:C36H52O11
InChI:InChI=1/C36H52O11/c1-6-7-19-35(47-34(44)17-16-32(40)41)21-22-36(46-30(35)14-10-25(3)23-33(42)43)20-18-27(5)29(45-36)13-9-24(2)8-12-28(37)26(4)11-15-31(38)39/h8-12,14-15,23,26-30,37H,6-7,13,16-22H2,1-5H3,(H,38,39)(H,40,41)(H,42,43)/b12-8+,14-10+,15-11+,24-9+,25-23+/t26-,27-,28-,29+,30-,35+,36-/m0/s1
Synonyms:- Mono(3-butyl-8-(9-carboxy-6-hydroxy-3,7-dimethyl-2,4,8-nonatrienyl)-2-(4-carboxy-3-methyl-1,3-butadienyl)-9-methyl-1,7-dioxaspiro(5.5)undec-3-yl) butanedioate
- Butanedioic acid, mono(3-butyl-8-(9-carboxy-6-hydroxy-3,7-dimethyl-2,4,8-nonatrienyl)-2-(4-carboxy-3-methyl-1,3-butadienyl)-9-methyl-1,7-dioxaspiro(5.5)undec-3-yl) ester
- (2E,6E,8E)-10-{9-butyl-8-[(1E,3E)-4-carboxy-3-methylbuta-1,3-dien-1-yl]-9-[(3-carboxypropanoyl)oxy]-3-methyl-1,7-dioxaspiro[5.5]undec-2-yl}-5-hydroxy-4,8-dimethyldeca-2,6,8-trienoic acid
- (2E,4S,5S,6E,8E)-10-{(2R,3S,6S,8S,9R)-9-butyl-8-[(1E,3E)-4-carboxy-3-methylbuta-1,3-dien-1-yl]-9-[(3-carboxypropanoyl)oxy]-3-methyl-1,7-dioxaspiro[5.5]undec-2-yl}-5-hydroxy-4,8-dimethyldeca-2,6,8-trienoic acid
- Reveromycin A
- ZESGNAJSBDILTB-OXVOKJAASA-N
- Butanedioic acid, 1-[(2S,3R,6S,8R,9S)-3-butyl-8-[(2E,4E,6S,7S,8E)-9-carboxy-6-hydroxy-3,7-dimethyl-2,4,8-nonatrien-1-yl]-2-[(1E,3E)-4-carboxy-3-methyl-1,3-butadien-1-yl]-9-methyl-1,7-dioxaspiro[5.5]undec-3-yl] ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Reveromycin A
CAS:Reveromycin A from Streptomyces sp. inhibits epidermal growth, tumors, and C. albicans; affects osteoclasts. IC50: 0.7-1.9 μg/ml; MIC: 2 μg/ml.Formula:C36H52O11Color and Shape:SolidMolecular weight:660.79

