CymitQuimica logo

CAS 134617-89-3

:

2-azaspiro[4.6]undecan-3-one

Description:
2-Azaspiro[4.6]undecan-3-one is a bicyclic compound characterized by its unique spiro structure, which consists of a nitrogen atom integrated into a bicyclic framework. This compound features a ketone functional group at the 3-position, contributing to its reactivity and potential applications in organic synthesis. The presence of the azaspiro moiety indicates that it has a nitrogen atom incorporated into the spiro system, which can influence its chemical properties, such as polarity and hydrogen bonding capabilities. Typically, compounds like 2-azaspiro[4.6]undecan-3-one exhibit moderate to high stability under standard conditions, but their reactivity can vary depending on the substituents and the environment. This compound may also exhibit biological activity, making it of interest in medicinal chemistry. Its structural characteristics suggest potential applications in drug development and materials science, particularly in the design of novel pharmaceuticals or functional materials. As with many nitrogen-containing heterocycles, it may also participate in various chemical reactions, including nucleophilic substitutions and cycloadditions.
Formula:C10H17NO
InChI:InChI=1/C10H17NO/c12-9-7-10(8-11-9)5-3-1-2-4-6-10/h1-8H2,(H,11,12)
SMILES:C1CCCC2(CC1)CC(=NC2)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.