CAS 1346229-50-2

1,1-Dimethylethyl 4-oxo-1-oxa-9-azaspiro[5.5]undec-2-ene-9-carboxylate

Description:

1,1-Dimethylethyl 4-oxo-1-oxa-9-azaspiro[5.5]undec-2-ene-9-carboxylate, with the CAS number 1346229-50-2, is a chemical compound characterized by its unique spirocyclic structure, which includes both an oxo and an oxa functional group. This compound features a complex arrangement of carbon, nitrogen, and oxygen atoms, contributing to its potential reactivity and biological activity. The presence of the dimethyl group enhances its steric properties, which may influence its interactions in chemical reactions or biological systems. Typically, such compounds may exhibit properties like moderate solubility in organic solvents and potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The spirocyclic framework often imparts interesting conformational characteristics, which can affect the compound's stability and reactivity. As with many organic compounds, safety and handling precautions should be observed, as the specific toxicity and environmental impact would depend on further studies and assessments.

Formula: C₁₄H₂₁NO₄

InChI: InChI=1S/C14H21NO4/c1-13(2,3)19-12(17)15-7-5-14(6-8-15)10-11(16)4-9-18-14/h4,9H,5-8,10H2,1-3H3

InChI key: InChIKey=NGVQWGUTUXGNJC-UHFFFAOYSA-N

SMILES: O=C1CC2(CCN(C(OC(C)(C)C)=O)CC2)OC=C1

Synonyms:

• 1,1-Dimethylethyl 4-oxo-1-oxa-9-azaspiro[5.5]undec-2-ene-9-carboxylate
• 1-Oxa-9-azaspiro[5.5]undec-2-ene-9-carboxylic acid, 4-oxo-, 1,1-dimethylethyl ester

tert-Butyl 4-oxo-1-oxa-9-azaspiro[5.5]undec-2-ene-9-carboxylate

CAS: 1346229-50-2

Versatile small molecule scaffold

Formula: C₁₄H₂₁NO₄

Purity: Min. 95%

Molecular weight: 267.32 g/mol

Ref: 3D-WDC22950