CAS 1346229-51-3

1,1-Dimethylethyl 4-oxo-1-oxa-9-azaspiro[5.5]undecane-9-carboxylate

Description:

1,1-Dimethylethyl 4-oxo-1-oxa-9-azaspiro[5.5]undecane-9-carboxylate, identified by its CAS number 1346229-51-3, is a chemical compound characterized by its complex spirocyclic structure, which includes both an oxo and an oxa functional group. This compound features a tert-butyl group (1,1-dimethylethyl) that contributes to its steric bulk, influencing its reactivity and solubility. The presence of the azaspiro moiety indicates that it contains nitrogen within a spirocyclic framework, which can impart unique properties such as potential biological activity. The carboxylate group suggests that the compound may exhibit acidic characteristics, making it relevant in various chemical reactions, including esterification and amidation. Its structural complexity may also lead to interesting interactions in biological systems, potentially making it a candidate for pharmaceutical applications. Overall, the compound's unique structural features and functional groups contribute to its chemical behavior and potential utility in synthetic chemistry and drug development.

Formula: C₁₄H₂₃NO₄

InChI: InChI=1S/C14H23NO4/c1-13(2,3)19-12(17)15-7-5-14(6-8-15)10-11(16)4-9-18-14/h4-10H2,1-3H3

InChI key: InChIKey=OGPIVLKPBUTGSD-UHFFFAOYSA-N

SMILES: O=C1CC2(CCN(C(OC(C)(C)C)=O)CC2)OCC1

Synonyms:

• 1-Oxa-9-azaspiro[5.5]undecane-9-carboxylic acid, 4-oxo-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl 4-oxo-1-oxa-9-azaspiro[5.5]undecane-9-carboxylate

tert-Butyl 4-oxo-1-oxa-9-azaspiro[5.5]undecane-9-carboxylate

CAS: 1346229-51-3

Versatile small molecule scaffold

Formula: C₁₄H₂₃NO₄

Purity: Min. 95%

Molecular weight: 269.34 g/mol

Ref: 3D-WDC22951