CAS 1346242-32-7
:(αS)-N,N,α-Trimethyl-3-(4-nitrophenoxy)benzenemethanamine
Description:
(αS)-N,N,α-Trimethyl-3-(4-nitrophenoxy)benzenemethanamine is a chemical compound characterized by its specific structural features, including a trimethylamine group and a nitrophenoxy substituent on a benzene ring. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds. The presence of the nitro group introduces electron-withdrawing characteristics, which can influence the compound's reactivity and solubility in various solvents. The stereochemistry indicated by (αS) suggests that the compound has a specific spatial arrangement, which may affect its biological activity and interactions with other molecules. As a result, this compound could be of interest in pharmaceutical research or as a potential intermediate in organic synthesis. Its unique combination of functional groups may also impart specific physical properties, such as melting point and boiling point, which are essential for applications in various chemical processes. Overall, the compound's characteristics make it a subject of interest in both academic and industrial chemistry contexts.
Formula:C16H18N2O3
InChI:InChI=1S/C16H18N2O3/c1-12(17(2)3)13-5-4-6-16(11-13)21-15-9-7-14(8-10-15)18(19)20/h4-12H,1-3H3/t12-/m0/s1
InChI key:InChIKey=IGNXGHWUJLKYJA-LBPRGKRZSA-N
SMILES:O(C1=CC([C@@H](N(C)C)C)=CC=C1)C2=CC=C(N(=O)=O)C=C2
Synonyms:- Benzenemethanamine, N,N,α-trimethyl-3-(4-nitrophenoxy)-, (αS)-
- (1S)-N,N-Dimethyl-1-[3-(4-nitrophenoxy)phenyl]ethanamine
- (αS)-N,N,α-Trimethyl-3-(4-nitrophenoxy)benzenemethanamine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Rivastigmine Impurity 3 HCl
CAS:Formula:C16H18N2O3·HClColor and Shape:White To Off-White SolidMolecular weight:286.33 36.46(alphaS)-N,N,alpha-Trimethyl-3-(4-nitrophenoxy)benzenemethanamine
CAS:Controlled ProductApplications (αS)-N,N,α-Trimethyl-3-(4-nitrophenoxy)benzenemethanamine is an impurity of Rivastigmine Tartrate (R541000). Rivastigmine Tartrate is a brain selective acetylcholinesterase inhibitor.
References Rosler, M., et al.: Brit. Med. J., 318, 633 (1999); Enz, A., et al.: Prog. Brain Res., 98, 431 (1993)Formula:C16H18N2O3Color and Shape:OrangeMolecular weight:286.33(rac)-N,N,α-Trimethyl-d6-3-(4-nitrophenoxy)benzenemethanamine
CAS:Controlled ProductFormula:C16D6H12N2O3Color and Shape:NeatMolecular weight:292.363(Alphas)-N,N,alpha-trimethyl-3-(4-nitrophenoxy)benzenemethanamine
CAS:(Alphas)-N,N,alpha-trimethyl-3-(4-nitrophenoxy)benzenemethanamine is a drug product that has been synthesized for research and development purposes. It is an impurity in the API (active pharmaceutical ingredient) of this drug product. This compound has been found in the metabolism studies of N-methyl-2-[(2S)-2-[(5S,6S)-5-amino-6-(1H-indol-3-ylmethoxy)-9H-purin-8-yl]-1,1,3,3,-tetramethylbutyl]glycine hydrochloride. The CAS number for this compound is 1346242-32-7.Formula:C16H18N2O3Purity:Min. 95%Molecular weight:286.33 g/mol




