
CAS 1346245-37-1
:3-Amino-5-methoxy-N-methylbenzamide
Description:
3-Amino-5-methoxy-N-methylbenzamide is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with an amino group, a methoxy group, and a methylamide group. The presence of the amino group (-NH2) indicates that it can participate in hydrogen bonding, potentially enhancing its solubility in polar solvents. The methoxy group (-OCH3) contributes to the compound's electron-donating properties, which can influence its reactivity and interaction with biological targets. The N-methyl group in the amide structure suggests that the compound may exhibit specific steric and electronic properties, affecting its pharmacological profile. This compound may be of interest in medicinal chemistry due to its potential biological activity, although specific applications would depend on further research and characterization. Overall, 3-Amino-5-methoxy-N-methylbenzamide presents a unique combination of functional groups that could be explored for various chemical and biological applications.
Formula:C9H12N2O2
InChI:InChI=1S/C9H12N2O2/c1-11-9(12)6-3-7(10)5-8(4-6)13-2/h3-5H,10H2,1-2H3,(H,11,12)
InChI key:InChIKey=KOQALAOBEFSOPH-UHFFFAOYSA-N
SMILES:C(NC)(=O)C1=CC(OC)=CC(N)=C1
Synonyms:- Benzamide, 3-amino-5-methoxy-N-methyl-
- 3-Amino-5-methoxy-N-methylbenzamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.