CAS 1346270-24-3

5-(5-Methyl-2-furanyl)-1H-pyrazole-3-carboxamide

Description:

5-(5-Methyl-2-furanyl)-1H-pyrazole-3-carboxamide is a chemical compound characterized by its unique structural features, which include a pyrazole ring and a furan moiety. The presence of the 5-methyl-2-furanyl group contributes to its aromatic properties, while the carboxamide functional group enhances its potential for hydrogen bonding and solubility in polar solvents. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests potential interactions with biological targets, which could lead to various pharmacological effects. Additionally, the compound's stability and reactivity can be influenced by the substituents on the pyrazole and furan rings. As with many organic compounds, its physical properties, such as melting point, boiling point, and solubility, would depend on the specific conditions and the presence of other functional groups. Overall, 5-(5-Methyl-2-furanyl)-1H-pyrazole-3-carboxamide represents a class of compounds that may have significant implications in chemical research and applications.

Formula: C₉H₉N₃O₂

InChI: InChI=1S/C9H9N3O2/c1-5-2-3-8(14-5)6-4-7(9(10)13)12-11-6/h2-4H,1H3,(H2,10,13)(H,11,12)

InChI key: InChIKey=JPMMMRIYZDXZKK-UHFFFAOYSA-N

SMILES: C(N)(=O)C=1C=C(NN1)C=2OC(C)=CC2

Synonyms:

• 5-(5-Methyl-2-furanyl)-1H-pyrazole-3-carboxamide
• 1H-Pyrazole-3-carboxamide, 5-(5-methyl-2-furanyl)-