CymitQuimica logo

CAS 134640-85-0

:

2,3-DIMETHYLPHENYLMAGNESIUM BROMIDE

Description:
2,3-Dimethylphenylmagnesium bromide is an organomagnesium compound, specifically a Grignard reagent, characterized by its reactivity and utility in organic synthesis. This compound features a phenyl ring substituted with two methyl groups at the 2 and 3 positions, which influences its steric and electronic properties. As a Grignard reagent, it is highly reactive towards electrophiles, making it valuable for forming carbon-carbon bonds in various synthetic pathways. The presence of the magnesium atom allows for nucleophilic attack on carbonyl compounds, leading to the formation of alcohols upon hydrolysis. Additionally, the bromide ion serves as a leaving group, facilitating the formation of the Grignard reagent from the corresponding aryl bromide. Due to its reactivity, 2,3-dimethylphenylmagnesium bromide must be handled under anhydrous conditions to prevent decomposition or reaction with moisture. Safety precautions are essential, as Grignard reagents can react violently with water and air. Overall, this compound is significant in the field of synthetic organic chemistry for its ability to introduce complex functionalities into molecules.
Formula:C8H9BrMg
InChI:InChI=1/C8H9.BrH.Mg/c1-7-5-3-4-6-8(7)2;;/h3-5H,1-2H3;1H;/q-1;;+2/p-1
SMILES:Cc1ccc[c-]c1C.Br.[Mg]
Synonyms:
  • Magnesium Bromide 2,3-Dimethylbenzenide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.