CAS 1346446-85-2

3,4-Dihydro-6-iodo-2H-pyrano[2,3-b]pyridine

Description:

3,4-Dihydro-6-iodo-2H-pyrano[2,3-b]pyridine is a heterocyclic organic compound characterized by its fused pyridine and pyran rings. The presence of the iodine atom at the 6-position contributes to its reactivity and potential applications in medicinal chemistry. This compound typically exhibits a pale yellow to brownish color and is soluble in organic solvents, which is common for many heterocycles. Its structure suggests potential biological activity, making it a candidate for further pharmacological studies. The dihydro configuration indicates that it has two hydrogen atoms added to the pyridine ring, which can influence its electronic properties and stability. The compound's unique structural features may allow for interactions with biological targets, making it of interest in drug development. Additionally, the presence of halogens like iodine often enhances the lipophilicity of compounds, potentially affecting their absorption and distribution in biological systems. Overall, 3,4-Dihydro-6-iodo-2H-pyrano[2,3-b]pyridine represents a valuable structure for exploration in synthetic and medicinal chemistry.

Formula: C₈H₈INO

InChI: InChI=1S/C8H8INO/c9-7-4-6-2-1-3-11-8(6)10-5-7/h4-5H,1-3H2

InChI key: InChIKey=RJRLPTMLGNPCRQ-UHFFFAOYSA-N

SMILES: IC=1C=C2C(=NC1)OCCC2

Synonyms:

• 3,4-Dihydro-6-iodo-2H-pyrano[2,3-b]pyridine
• 2H-Pyrano[2,3-b]pyridine, 3,4-dihydro-6-iodo-
• 6-Iodo-3,4-dihydro-2H-pyrano[2,3-b]pyridine
• 6-Iodo-2h,3h,4h-pyrano[2,3-b]pyridine