CymitQuimica logo

CAS 1346446-87-4

:

3,4-Dihydro-2H-pyrano[2,3-b]pyridine-6-methanol

Description:
3,4-Dihydro-2H-pyrano[2,3-b]pyridine-6-methanol is a heterocyclic organic compound characterized by its fused pyridine and pyran rings. This compound features a dihydropyrano structure, which contributes to its unique chemical properties. The presence of a hydroxymethyl group at the 6-position enhances its reactivity and potential for hydrogen bonding, making it of interest in various chemical reactions and applications. The molecular structure suggests that it may exhibit biological activity, potentially serving as a scaffold for drug development. Its solubility and stability can vary depending on the solvent and conditions, which is crucial for its application in medicinal chemistry. Additionally, the compound's synthesis may involve multi-step organic reactions, highlighting its complexity. As with many heterocycles, it may also display interesting electronic properties due to the conjugation within its ring system. Overall, 3,4-Dihydro-2H-pyrano[2,3-b]pyridine-6-methanol represents a versatile compound with potential implications in pharmaceuticals and organic synthesis.
Formula:C9H11NO2
InChI:InChI=1S/C9H11NO2/c11-6-7-4-8-2-1-3-12-9(8)10-5-7/h4-5,11H,1-3,6H2
InChI key:InChIKey=XBVQYXNQVLAKRM-UHFFFAOYSA-N
SMILES:C(O)C=1C=C2C(=NC1)OCCC2
Synonyms:
  • 2H-Pyrano[2,3-b]pyridine-6-methanol, 3,4-dihydro-
  • 3,4-Dihydro-2H-pyrano[2,3-b]pyridine-6-methanol
  • 3,4-Dihydro-2H-pyrano[2,3-b]pyridin-6-ylmethanol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.