CAS 1346446-90-9
:2,5-Dichloro-3-[2-(trimethylsilyl)ethynyl]pyridine
Description:
2,5-Dichloro-3-[2-(trimethylsilyl)ethynyl]pyridine is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing nitrogen. The presence of two chlorine atoms at the 2 and 5 positions of the pyridine ring contributes to its reactivity and potential applications in various chemical reactions. The ethynyl group, substituted with a trimethylsilyl group, enhances the compound's stability and solubility in organic solvents, making it useful in synthetic organic chemistry. This compound is typically utilized in the development of pharmaceuticals and agrochemicals due to its unique structural features that allow for further functionalization. Additionally, the trimethylsilyl group can serve as a protecting group in organic synthesis, facilitating the manipulation of other reactive functional groups. Overall, 2,5-Dichloro-3-[2-(trimethylsilyl)ethynyl]pyridine exhibits a combination of halogenation and silylation that makes it a versatile intermediate in chemical synthesis.
Formula:C10H11Cl2NSi
InChI:InChI=1S/C10H11Cl2NSi/c1-14(2,3)5-4-8-6-9(11)7-13-10(8)12/h6-7H,1-3H3
InChI key:InChIKey=DQOWNDLHIUKVTA-UHFFFAOYSA-N
SMILES:C(#C[Si](C)(C)C)C1=C(Cl)N=CC(Cl)=C1
Synonyms:- 2,5-Dichloro-3-[2-(trimethylsilyl)ethynyl]pyridine
- Pyridine, 2,5-dichloro-3-[2-(trimethylsilyl)ethynyl]-
- 2,5-Dichloro-3-((trimethylsilyl)ethynyl)pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.