CymitQuimica logo

CAS 1346446-92-1

:

5-Chloro-6-iodo-1H-pyrrolo[2,3-b]pyridine-4-methanol

Description:
5-Chloro-6-iodo-1H-pyrrolo[2,3-b]pyridine-4-methanol is a heterocyclic organic compound characterized by its complex structure, which includes a pyrrolopyridine framework. This compound features a chlorine atom at the 5-position and an iodine atom at the 6-position of the pyrrolopyridine ring, contributing to its unique reactivity and potential biological activity. The presence of a hydroxymethyl group at the 4-position enhances its solubility and may influence its interaction with biological targets. The molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of halogen substituents that can modulate biological activity. Additionally, the compound may exhibit interesting properties such as fluorescence or specific binding affinities, making it a candidate for further research in drug discovery and development. Its CAS number, 1346446-92-1, allows for easy identification and retrieval of information related to its synthesis, properties, and potential applications in scientific literature.
Formula:C8H6ClIN2O
InChI:InChI=1S/C8H6ClIN2O/c9-6-5(3-13)4-1-2-11-8(4)12-7(6)10/h1-2,13H,3H2,(H,11,12)
InChI key:InChIKey=DQWLHKSCQUASNP-UHFFFAOYSA-N
SMILES:C(O)C1=C2C(=NC(I)=C1Cl)NC=C2
Synonyms:
  • 5-Chloro-6-iodo-1H-pyrrolo[2,3-b]pyridine-4-methanol
  • 1H-Pyrrolo[2,3-b]pyridine-4-methanol, 5-chloro-6-iodo-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.