CAS 1346446-94-3

1,1-Dimethylethyl N-(7-chloro-2,3-dihydro-1,4-dioxino[2,3-b]pyridin-6-yl)carbamate

Description:

1,1-Dimethylethyl N-(7-chloro-2,3-dihydro-1,4-dioxino[2,3-b]pyridin-6-yl)carbamate, identified by its CAS number 1346446-94-3, is a chemical compound characterized by its complex structure, which includes a carbamate functional group and a substituted pyridine moiety. The presence of the 7-chloro substituent indicates potential biological activity, as halogenated compounds often exhibit enhanced pharmacological properties. The dioxin ring contributes to the compound's stability and may influence its reactivity and solubility. This compound is likely to be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its unique structural features that may interact with biological targets. Its synthesis and characterization would involve standard organic chemistry techniques, and its properties, such as solubility, melting point, and spectral data, would be essential for understanding its behavior in various environments. Safety and handling considerations are crucial, especially given the presence of chlorine and the potential for biological activity.

Formula: C₁₂H₁₅ClN₂O₄

InChI: InChI=1S/C12H15ClN2O4/c1-12(2,3)19-11(16)15-9-7(13)6-8-10(14-9)18-5-4-17-8/h6H,4-5H2,1-3H3,(H,14,15,16)

InChI key: InChIKey=SYDXKMMBOQVVSA-UHFFFAOYSA-N

SMILES: N(C(OC(C)(C)C)=O)C=1N=C2C(=CC1Cl)OCCO2

Synonyms:

• Carbamic acid, N-(7-chloro-2,3-dihydro-1,4-dioxino[2,3-b]pyridin-6-yl)-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl N-(7-chloro-2,3-dihydro-1,4-dioxino[2,3-b]pyridin-6-yl)carbamate
• tert-Butyl (7-chloro-2,3-dihydro-[1,4]-dioxino[2,3-b]pyridin-6-yl)carbamate