CymitQuimica logo

CAS 1346446-95-4

:

5-Fluoro-3-iodo-1H-pyrrolo[2,3-b]pyridine-4-carbonitrile

Description:
5-Fluoro-3-iodo-1H-pyrrolo[2,3-b]pyridine-4-carbonitrile is a heterocyclic organic compound characterized by its complex structure, which includes a pyrrolopyridine framework. This compound features a fluorine atom and an iodine atom substituted on the pyrrole ring, contributing to its unique reactivity and potential biological activity. The presence of the carbonitrile group enhances its polarity and can influence its solubility in various solvents. Typically, compounds of this nature are of interest in medicinal chemistry due to their potential as pharmaceutical agents, particularly in targeting specific biological pathways. The halogen substituents (fluorine and iodine) can significantly affect the compound's electronic properties, stability, and interaction with biological targets. Additionally, the compound's synthesis and characterization involve standard organic chemistry techniques, including NMR and mass spectrometry, to confirm its structure and purity. Overall, 5-Fluoro-3-iodo-1H-pyrrolo[2,3-b]pyridine-4-carbonitrile represents a valuable scaffold for further research and development in drug discovery.
Formula:C8H3FIN3
InChI:InChI=1S/C8H3FIN3/c9-5-2-12-8-7(4(5)1-11)6(10)3-13-8/h2-3H,(H,12,13)
InChI key:InChIKey=PWBYLJNSRUKWSM-UHFFFAOYSA-N
SMILES:C(#N)C1=C2C(=NC=C1F)NC=C2I
Synonyms:
  • 1H-Pyrrolo[2,3-b]pyridine-4-carbonitrile, 5-fluoro-3-iodo-
  • 5-Fluoro-3-iodo-1H-pyrrolo[2,3-b]pyridine-4-carbonitrile
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.