CAS 1346446-97-6
:N-(2-Chloro-4-cyano-6-iodo-3-pyridinyl)-2,2-dimethylpropanamide
Description:
N-(2-Chloro-4-cyano-6-iodo-3-pyridinyl)-2,2-dimethylpropanamide is a chemical compound characterized by its complex structure, which includes a pyridine ring substituted with chlorine, cyano, and iodine groups. This compound features a propanamide functional group, indicating it has an amide bond, which contributes to its potential biological activity. The presence of halogen atoms (chlorine and iodine) often enhances the lipophilicity and biological interactions of the molecule, making it of interest in medicinal chemistry. The cyano group can also impart unique reactivity and properties, potentially influencing the compound's solubility and stability. Overall, this compound may exhibit specific pharmacological properties, making it a candidate for further research in drug development or agrochemical applications. Its unique combination of functional groups suggests potential applications in various fields, including pharmaceuticals and materials science. However, detailed studies would be necessary to fully understand its behavior and interactions in biological systems.
Formula:C11H11ClIN3O
InChI:InChI=1S/C11H11ClIN3O/c1-11(2,3)10(17)16-8-6(5-14)4-7(13)15-9(8)12/h4H,1-3H3,(H,16,17)
InChI key:InChIKey=KOKBLLPPULBISC-UHFFFAOYSA-N
SMILES:N(C(C(C)(C)C)=O)C=1C(C#N)=CC(I)=NC1Cl
Synonyms:- N-(2-Chloro-4-cyano-6-iodo-3-pyridinyl)-2,2-dimethylpropanamide
- Propanamide, N-(2-chloro-4-cyano-6-iodo-3-pyridinyl)-2,2-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.