CymitQuimica logo

CAS 1346447-00-4

:

3-Fluoro-5-(3-hydroxypropyl)-2-pyridinecarbonitrile

Description:
3-Fluoro-5-(3-hydroxypropyl)-2-pyridinecarbonitrile is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a fluorine atom at the 3-position and a hydroxyl-propyl group at the 5-position contributes to its unique reactivity and solubility properties. The cyano group (-C≡N) at the 2-position enhances its potential for nucleophilic reactions and makes it a valuable intermediate in organic synthesis. This compound may exhibit polar characteristics due to the hydroxyl group, influencing its interactions in various solvents. Additionally, the presence of the fluorine atom can impart specific electronic properties, potentially affecting its biological activity and pharmacological profile. Overall, 3-Fluoro-5-(3-hydroxypropyl)-2-pyridinecarbonitrile is of interest in medicinal chemistry and material science, where its structural features can be leveraged for the development of novel compounds.
Formula:C9H9FN2O
InChI:InChI=1S/C9H9FN2O/c10-8-4-7(2-1-3-13)6-12-9(8)5-11/h4,6,13H,1-3H2
InChI key:InChIKey=NJWTUIURZDXJEU-UHFFFAOYSA-N
SMILES:C(CCO)C=1C=C(F)C(C#N)=NC1
Synonyms:
  • 2-Pyridinecarbonitrile, 3-fluoro-5-(3-hydroxypropyl)-
  • 3-Fluoro-5-(3-hydroxypropyl)-2-pyridinecarbonitrile
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.