CAS 1346447-02-6

8-(Dimethoxymethyl)-3,4-dihydro-2H-pyrano[3,2-b]pyridine

Description:

8-(Dimethoxymethyl)-3,4-dihydro-2H-pyrano[3,2-b]pyridine is a chemical compound characterized by its unique bicyclic structure, which combines elements of pyridine and pyran. This compound features a dihydropyran moiety fused to a pyridine ring, contributing to its potential biological activity. The presence of dimethoxymethyl groups enhances its solubility and may influence its reactivity and interaction with biological targets. Typically, compounds of this nature are studied for their pharmacological properties, including potential applications in medicinal chemistry. The molecular structure suggests that it may exhibit interesting electronic properties due to the conjugation between the aromatic and aliphatic systems. Additionally, the presence of methoxy groups can provide sites for further chemical modifications, making it a versatile scaffold for drug development. As with many organic compounds, its stability, reactivity, and biological activity would depend on various factors, including environmental conditions and the presence of other chemical entities. Further research would be necessary to fully elucidate its properties and potential applications.

Formula: C₁₁H₁₅NO₃

InChI: InChI=1S/C11H15NO3/c1-13-11(14-2)8-5-6-12-9-4-3-7-15-10(8)9/h5-6,11H,3-4,7H2,1-2H3

InChI key: InChIKey=IQORIRIXLHFDBI-UHFFFAOYSA-N

SMILES: C(OC)(OC)C1=C2C(=NC=C1)CCCO2

Synonyms:

• 2H-Pyrano[3,2-b]pyridine, 8-(dimethoxymethyl)-3,4-dihydro-
• 8-(Dimethoxymethyl)-3,4-dihydro-2H-pyrano[3,2-b]pyridine