CymitQuimica logo

CAS 1346447-07-1

:

1H-Pyrazolo[3,4-b]pyridine-5-propanol

Description:
1H-Pyrazolo[3,4-b]pyridine-5-propanol is a heterocyclic organic compound characterized by its unique pyrazolo-pyridine structure, which consists of a fused pyrazole and pyridine ring system. This compound features a hydroxyl group (-OH) attached to a propanol chain at the 5-position of the pyrazolo ring, contributing to its potential as a bioactive molecule. The presence of both nitrogen atoms in the ring structure enhances its ability to participate in various chemical reactions, making it of interest in medicinal chemistry and drug development. Its molecular framework may exhibit diverse biological activities, including potential anti-inflammatory or neuroprotective effects, although specific biological data would depend on empirical studies. The compound's solubility, stability, and reactivity can be influenced by the functional groups present, and it may interact with biological targets through hydrogen bonding or coordination. Overall, 1H-Pyrazolo[3,4-b]pyridine-5-propanol represents a class of compounds that could be explored for therapeutic applications, pending further research and characterization.
Formula:C9H11N3O
InChI:InChI=1S/C9H11N3O/c13-3-1-2-7-4-8-6-11-12-9(8)10-5-7/h4-6,13H,1-3H2,(H,10,11,12)
InChI key:InChIKey=KYOFTGPWORJBNR-UHFFFAOYSA-N
SMILES:C(CCO)C=1C=C2C(=NC1)NN=C2
Synonyms:
  • 1H-Pyrazolo[3,4-b]pyridine-5-propanol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.