CymitQuimica logo

CAS 1346447-09-3

:

3,4-Dihydro-6-iodo-2H-pyrano[3,2-b]pyridine-8-carbonitrile

Description:
3,4-Dihydro-6-iodo-2H-pyrano[3,2-b]pyridine-8-carbonitrile is a heterocyclic organic compound characterized by its complex bicyclic structure, which includes a pyridine and a pyran ring. The presence of the iodine atom at the 6-position contributes to its reactivity and potential applications in medicinal chemistry. The carbonitrile functional group at the 8-position enhances its polarity and may influence its biological activity. This compound is typically synthesized through multi-step organic reactions, often involving halogenation and cyclization processes. Its unique structure may impart specific pharmacological properties, making it of interest in drug discovery and development. Additionally, the compound's solubility, stability, and reactivity can vary based on the functional groups present, which are critical for its potential applications in various fields, including pharmaceuticals and agrochemicals. As with many heterocycles, the electronic properties and steric factors play a significant role in determining its interactions with biological targets.
Formula:C9H7IN2O
InChI:InChI=1S/C9H7IN2O/c10-8-4-6(5-11)9-7(12-8)2-1-3-13-9/h4H,1-3H2
InChI key:InChIKey=LXOPXZLUEKMJMG-UHFFFAOYSA-N
SMILES:C(#N)C1=C2C(=NC(I)=C1)CCCO2
Synonyms:
  • 3,4-Dihydro-6-iodo-2H-pyrano[3,2-b]pyridine-8-carbonitrile
  • 2H-Pyrano[3,2-b]pyridine-8-carbonitrile, 3,4-dihydro-6-iodo-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.