
CAS 1346447-11-7
:1,1-Dimethylethyl N,N-bis[(3-fluoro-2-pyridinyl)methyl]carbamate
Description:
1,1-Dimethylethyl N,N-bis[(3-fluoro-2-pyridinyl)methyl]carbamate, identified by its CAS number 1346447-11-7, is a chemical compound characterized by its unique structure, which includes a carbamate functional group and two 3-fluoro-2-pyridinyl moieties. This compound is typically a solid at room temperature and exhibits moderate solubility in organic solvents. Its molecular structure suggests potential applications in agrochemicals or pharmaceuticals, particularly due to the presence of the pyridine rings, which can enhance biological activity. The fluorine substituent may also contribute to its lipophilicity and stability. Additionally, the presence of the tert-butyl group (1,1-dimethylethyl) may provide steric hindrance, influencing its reactivity and interaction with biological targets. As with many chemical substances, safety data should be consulted to understand its toxicity, handling precautions, and environmental impact. Overall, this compound's specific characteristics make it a subject of interest in various chemical research fields.
Formula:C17H19F2N3O2
InChI:InChI=1S/C17H19F2N3O2/c1-17(2,3)24-16(23)22(10-14-12(18)6-4-8-20-14)11-15-13(19)7-5-9-21-15/h4-9H,10-11H2,1-3H3
InChI key:InChIKey=NCLCGLXSDYMZJL-UHFFFAOYSA-N
SMILES:N(CC1=C(F)C=CC=N1)(CC2=C(F)C=CC=N2)C(OC(C)(C)C)=O
Synonyms:- Carbamic acid, N,N-bis[(3-fluoro-2-pyridinyl)methyl]-, 1,1-dimethylethyl ester
- 1,1-Dimethylethyl N,N-bis[(3-fluoro-2-pyridinyl)methyl]carbamate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.