CAS 1346447-12-8
:3-Amino-5-(3-hydroxy-1-propyn-1-yl)-2-pyridinecarbonitrile
Description:
3-Amino-5-(3-hydroxy-1-propyn-1-yl)-2-pyridinecarbonitrile is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of an amino group (-NH2) at the 3-position and a cyano group (-C≡N) at the 2-position contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. The compound also features a propynyl side chain with a hydroxyl group, which enhances its solubility and may influence its biological activity. The structural complexity of this molecule suggests potential interactions with biological targets, making it of interest in drug development. Its CAS number, 1346447-12-8, allows for precise identification in chemical databases. Overall, this compound's unique functional groups and structural features may provide avenues for research in various fields, including pharmaceuticals and agrochemicals.
Formula:C9H7N3O
InChI:InChI=1S/C9H7N3O/c10-5-9-8(11)4-7(6-12-9)2-1-3-13/h4,6,13H,3,11H2
InChI key:InChIKey=DBAQBWGHEGYWKE-UHFFFAOYSA-N
SMILES:C(#CCO)C=1C=C(N)C(C#N)=NC1
Synonyms:- 2-Pyridinecarbonitrile, 3-amino-5-(3-hydroxy-1-propyn-1-yl)-
- 3-Amino-5-(3-hydroxy-1-propyn-1-yl)-2-pyridinecarbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.