CAS 1346447-13-9
:Methyl 7-chloro-2,3-dihydro-1,4-dioxino[2,3-b]pyridine-8-carboxylate
Description:
Methyl 7-chloro-2,3-dihydro-1,4-dioxino[2,3-b]pyridine-8-carboxylate is a chemical compound characterized by its unique bicyclic structure, which includes a pyridine ring fused with a dioxin moiety. The presence of a chlorine atom at the 7-position and a carboxylate ester group contributes to its reactivity and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of functional groups that can participate in various chemical reactions. Additionally, the compound may possess interesting pharmacological properties, making it a candidate for further research in drug discovery. Safety and handling precautions should be observed, as with any chemical substance, particularly those with halogenated components.
Formula:C9H8ClNO4
InChI:InChI=1S/C9H8ClNO4/c1-13-9(12)6-5(10)4-11-8-7(6)14-2-3-15-8/h4H,2-3H2,1H3
InChI key:InChIKey=FDZQIVVEPFUVKE-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=C2C(=NC=C1Cl)OCCO2
Synonyms:- 1,4-Dioxino[2,3-b]pyridine-8-carboxylic acid, 7-chloro-2,3-dihydro-, methyl ester
- Methyl 7-chloro-2,3-dihydro-1,4-dioxino[2,3-b]pyridine-8-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.