CAS 1346447-14-0
:7-Chloro-2,3-dihydro-1,4-dioxino[2,3-b]pyridine-8-methanol
Description:
7-Chloro-2,3-dihydro-1,4-dioxino[2,3-b]pyridine-8-methanol is a chemical compound characterized by its unique bicyclic structure, which incorporates both a pyridine and a dioxin moiety. The presence of a chlorine atom at the 7-position and a hydroxymethyl group at the 8-position contributes to its reactivity and potential biological activity. This compound may exhibit properties such as solubility in polar solvents due to the hydroxymethyl group, while the dioxin ring can influence its stability and interaction with biological systems. The molecular framework suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as compounds with similar structures often show diverse biological activities. Additionally, the presence of the chlorine substituent may enhance lipophilicity, affecting the compound's pharmacokinetics. However, specific characteristics such as melting point, boiling point, and spectral data would require empirical measurement or literature reference for precise values. Overall, this compound represents a fascinating area of study in organic and medicinal chemistry.
Formula:C8H8ClNO3
InChI:InChI=1S/C8H8ClNO3/c9-6-3-10-8-7(5(6)4-11)12-1-2-13-8/h3,11H,1-2,4H2
InChI key:InChIKey=YKVVXYYYNBHYTE-UHFFFAOYSA-N
SMILES:C(O)C1=C2C(=NC=C1Cl)OCCO2
Synonyms:- 7-Chloro-2,3-dihydro-1,4-dioxino[2,3-b]pyridine-8-methanol
- 1,4-Dioxino[2,3-b]pyridine-8-methanol, 7-chloro-2,3-dihydro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.